Diethyl benzylmalonate structure
|
Common Name | Diethyl benzylmalonate | ||
|---|---|---|---|---|
| CAS Number | 607-81-8 | Molecular Weight | 250.290 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 300.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | 164 - 166ºC | |
| MSDS | Chinese USA | Flash Point | 154.7±20.7 °C | |
| Name | Diethyl benzylmalonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.0±0.0 °C at 760 mmHg |
| Melting Point | 164 - 166ºC |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.290 |
| Flash Point | 154.7±20.7 °C |
| Exact Mass | 250.120514 |
| PSA | 52.60000 |
| LogP | 2.76 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | ICZLTZWATFXDLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)OCC |
| Storage condition | Refrigerator |
| Water Solubility | immiscible |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 29173980 |
|---|
|
[Central depressant drugs. 3. 3-Aromatic-aliphatic-substituted 4-hydroxypyrimido-[1,2-a]benzimidazol-2-ones].
Arzneimittelforschung 33(11) , 1517-8, (1983) Within the structural class of pyrimidol[1,2-a]benzimidazole-2,4-diones accessible through condensation of 2-amino-benzimidazole (1) with malonates (2) there occur representatives exhibiting centrally... |
|
|
Enzymatic asymmetrization of prochiral 2-benzyl-1, 3-propanediol through esterification in solvent media. Ducret A, et al.
Biotechnol. Lett. 22(8) , 709-713, (2000)
|
|
|
Dioxygen adducts of nickel (II) and cobalt (II) dioxopentaazamacrocyclic complexes: Kinetics, stabilities, and hydroxylation of the ligands in the nickel dioxygen complexes. Chen D, et al.
Inorg. Chem. 30(6) , 1396-1402, (1991)
|
| diethyl 2-benzylpropanedioate |
| EINECS 210-142-7 |
| Diethyl benzylmalonate |
| MFCD00009166 |
| 2OVY1R&VO2 |
| Propanedioic acid, 2-(phenylmethyl)-, diethyl ester |