3-(Acetylsulfanyl)-2-benzylpropanoic acid structure
|
Common Name | 3-(Acetylsulfanyl)-2-benzylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 91702-98-6 | Molecular Weight | 238.303 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 387.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O3S | Melting Point | 39 °C | |
| MSDS | N/A | Flash Point | 188.4±24.6 °C | |
| Name | 2-[(Acetylthio)methyl]-3-phenylpropionic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.9±30.0 °C at 760 mmHg |
| Melting Point | 39 °C |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.303 |
| Flash Point | 188.4±24.6 °C |
| Exact Mass | 238.066360 |
| PSA | 79.67000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | BCAAXVOKLXDSPD-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2930909090 |
|
~99%
3-(Acetylsulfan... CAS#:91702-98-6 |
| Literature: Neustadt; Smith; Nechuta; Bronnenkant; Haslanger; Watkins; Foster; Sybertz Journal of Medicinal Chemistry, 1994 , vol. 37, # 15 p. 2461 - 2476 |
|
~%
3-(Acetylsulfan... CAS#:91702-98-6 |
| Literature: US4263293 A1, ; |
|
~%
3-(Acetylsulfan... CAS#:91702-98-6 |
| Literature: Pharmazie, , vol. 61, # 12 p. 994 - 998 |
|
~%
3-(Acetylsulfan... CAS#:91702-98-6 |
| Literature: Pharmazie, , vol. 61, # 12 p. 994 - 998 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(Acetylsulfanyl)-2-benzylpropanoic acid |
| MFCD00236751 |
| Benzenepropanoic acid, α-[(acetylthio)methyl]- |
| 2-[(Acetylthio)methyl]-phenylpropionic acid |
| 3-{2-[(Acetylsulfanyl)methyl]phenyl}propanoic acid |
| Benzenepropanoic acid, 2-[(acetylthio)methyl]- |