(S)-1-(Benzyloxycarbonyl)hexahydropyridazine-3-carboxylic acid
(S)-1-(Benzyloxycarbonyl)hexahydropyridazine-3-carboxylic acid structure
|
Common Name | (S)-1-(Benzyloxycarbonyl)hexahydropyridazine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 65632-62-4 | Molecular Weight | 264.277 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 440.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H16N2O4 | Melting Point | 168-169°C | |
| MSDS | N/A | Flash Point | 220.0±31.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.2±55.0 °C at 760 mmHg |
| Melting Point | 168-169°C |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.277 |
| Flash Point | 220.0±31.5 °C |
| Exact Mass | 264.110992 |
| PSA | 78.87000 |
| LogP | 0.69 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | ZYBMAAOZXXKYTG-NSHDSACASA-N |
| SMILES | O=C(O)C1CCCN(C(=O)OCc2ccccc2)N1 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 1 | |
![phenylmethyl (3S)-hexahydro-3-[[(4S)-2-oxo-4-(phenylmethyl)-3-oxazolidinyl]carbonyl]-1-pyridazinecarboxylate Structure](https://image.chemsrc.com/caspic/320/672307-41-4.png)
CAS#:672307-41-4
CAS#:4509-90-4
CAS#:156699-37-5
CAS#:176237-44-8
CAS#:176237-45-9
CAS#:156699-39-7![TERT-BUTYL (1S,9S)-6,10-DIOXO-9-PHTHALIMIDOOCTAHYDROPYRIDAZO[1,2-A][1,2]DIAZEPINE-1-CARBOXYLATE structure](https://image.chemsrc.com/caspic/270/106928-72-7.png)
CAS#:106928-72-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| hexahydro-1-(benzyloxycarbonyl)-(3S)-pyridazinecarboxylic acid |
| (3S)-1-[(Benzyloxy)carbonyl]hexahydropyridazine-3-carboxylic acid |
| (3S)-N1-Cbz-piperazic acid |
| 1-(phenylmethyl) hydrogen tetrahydropyridazine-1,(3S)(2H)-dicarboxylate |
| (S)-1-Cbz-hexahydropyridazine-3-carboxylic acid |
| (S)-1-(Benzyloxycarbonyl)hexahydropyridazine-3-carboxylic acid |
| (3S)-hexahydro-1,3-pridazinedicarboxylic acid 1-(phenylmethyl) ester |
| N1-Z-(3S)-piperazic acid |
| (S)-1-(benzyloxycarbonyl)piperazine-3-carboxylic acid |
| (3S)-1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: Polar surface area (PSA) of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is 78.87000. |
| Q: What is the molecular weight of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: Molecular weight of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is 264.277. |
| Q: What is the InChIKey of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: InChIKey of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is ZYBMAAOZXXKYTG-NSHDSACASA-N. |
| Q: What is the CAS number of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: CAS number of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is 65632-62-4. |
| Q: What are the upstream materials of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: Related upstream materials(CAS) of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid: 672307-41-4;4509-90-4;156699-37-5;176237-44-8;176237-45-9;156699-39-7. |
| Q: What is the English name of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: The English name of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid. |
| Q: What is the boiling point of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: Boiling point of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is 440.2±55.0 °C at 760 mmHg. |
| Q: What is the molecular formula of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: Molecular formula of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is C13H16N2O4. |
| Q: What are the downstream products of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: Related downstream products(CAS) of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid: 106928-72-7. |
| Q: What is the LogP of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid? |
| A: LogP of (3S)-1-phenylmethoxycarbonyldiazinane-3-carboxylic acid is 0.69. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |