Butanoic acid,4-[(1,4-dihydro-1,4-dioxo-2-naphthalenyl)thio]- structure
|
Common Name | Butanoic acid,4-[(1,4-dihydro-1,4-dioxo-2-naphthalenyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 65726-67-2 | Molecular Weight | 276.30800 | |
| Density | 1.39g/cm3 | Boiling Point | 500.8ºC at 760mmHg | |
| Molecular Formula | C14H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.7ºC | |
| Name | 4-(1,4-dioxonaphthalen-2-yl)sulfanylbutanoic acid |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 500.8ºC at 760mmHg |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.30800 |
| Flash Point | 256.7ºC |
| Exact Mass | 276.04600 |
| PSA | 96.74000 |
| LogP | 2.54750 |
| Index of Refraction | 1.64 |
| InChIKey | BEFRYHVAAGJUCX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCSC1=CC(=O)c2ccccc2C1=O |
|
~43%
Butanoic acid,4... CAS#:65726-67-2 |
| Literature: Tandon, V. K.; Vaish, Meenu; Khan, Z. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 4 p. 445 - 448 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |