1,4-Naphthalenedione,2-[[4-(4-morpholinyl)-4-oxobutyl]thio]- structure
|
Common Name | 1,4-Naphthalenedione,2-[[4-(4-morpholinyl)-4-oxobutyl]thio]- | ||
|---|---|---|---|---|
| CAS Number | 65726-83-2 | Molecular Weight | 345.41300 | |
| Density | 1.33g/cm3 | Boiling Point | 570.5ºC at 760 mmHg | |
| Molecular Formula | C18H19NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.8ºC | |
| Name | 2-(4-morpholin-4-yl-4-oxobutyl)sulfanylnaphthalene-1,4-dione |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 570.5ºC at 760 mmHg |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.41300 |
| Flash Point | 298.8ºC |
| Exact Mass | 345.10300 |
| PSA | 88.98000 |
| LogP | 2.25960 |
| Index of Refraction | 1.627 |
| InChIKey | RORXZBTYFBWJQC-UHFFFAOYSA-N |
| SMILES | O=C1C=C(SCCCC(=O)N2CCOCC2)C(=O)c2ccccc21 |
|
~%
1,4-Naphthalene... CAS#:65726-83-2 |
| Literature: Singh,R. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1977 , vol. 15, p. 970 - 971 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |