AA38-3 structure
|
Common Name | AA38-3 | ||
|---|---|---|---|---|
| CAS Number | 65815-76-1 | Molecular Weight | 250.25 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 397.5±34.0 °C at 760 mmHg | |
| Molecular Formula | C12H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2±25.7 °C | |
Use of AA38-3AA38-3 is a serine hydrolase (SH) inhibitor. AA38-3 can inhibit three SHs, ABHD6, ABHD11, and FAAH[1]. |
| Name | 4-Nitrophenyl 1-piperidinecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | AA38-3 is a serine hydrolase (SH) inhibitor. AA38-3 can inhibit three SHs, ABHD6, ABHD11, and FAAH[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.5±34.0 °C at 760 mmHg |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 |
| Flash Point | 194.2±25.7 °C |
| Exact Mass | 250.095352 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | DHSYPQIMNAYLCG-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)N1CCCCC1 |
| 4-Nitrophenyl 1-piperidinecarboxylate |
| 4-Nitrophenyl piperidine-1-carboxylate |
| MFCD00276294 |
| 1-Piperidinecarboxylic acid, 4-nitrophenyl ester |