1H-Pyrrole-2,5-dione,1-(4-iodophenyl)- structure
|
Common Name | 1H-Pyrrole-2,5-dione,1-(4-iodophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 65833-01-4 | Molecular Weight | 299.06500 | |
| Density | 1.963g/cm3 | Boiling Point | 384.8ºC at 760mmHg | |
| Molecular Formula | C10H6INO2 | Melting Point | 160ºC | |
| MSDS | N/A | Flash Point | 186.5ºC | |
| Name | 1-(4-iodophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.963g/cm3 |
|---|---|
| Boiling Point | 384.8ºC at 760mmHg |
| Melting Point | 160ºC |
| Molecular Formula | C10H6INO2 |
| Molecular Weight | 299.06500 |
| Flash Point | 186.5ºC |
| Exact Mass | 298.94400 |
| PSA | 37.38000 |
| LogP | 1.78560 |
| Index of Refraction | 1.705 |
| InChIKey | GIXQASIEVHMYQH-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(I)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925190090 |
|
~26%
1H-Pyrrole-2,5-... CAS#:65833-01-4 |
| Literature: Organic Letters, , vol. 13, # 16 p. 4324 - 4327 |
|
~%
1H-Pyrrole-2,5-... CAS#:65833-01-4 |
| Literature: US5149824 A1, ; |
|
~%
1H-Pyrrole-2,5-... CAS#:65833-01-4 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 9 p. 2823 - 2834 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| iodophenylpyrroledione |
| p-iodo-N-phenylmaleimide |