N-[3-(2-formamidophenyl)-3-oxopropyl]acetamide structure
|
Common Name | N-[3-(2-formamidophenyl)-3-oxopropyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 65853-80-7 | Molecular Weight | 234.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-(2-formamidophenyl)-3-oxopropyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14N2O3 |
|---|---|
| Molecular Weight | 234.25100 |
| Exact Mass | 234.10000 |
| PSA | 82.25000 |
| LogP | 2.45360 |
| InChIKey | QLDWOSIDMFWKQC-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCC(=O)c1ccccc1NC=O |
|
~70%
N-[3-(2-formami... CAS#:65853-80-7 |
| Literature: Tsuji, Jiro; Kezuka, Hiroaki; Takayanagi, Hiroshi; Yamamoto, Keiji Bulletin of the Chemical Society of Japan, 1981 , vol. 54, # 8 p. 2369 - 2373 |
|
~14%
N-[3-(2-formami... CAS#:65853-80-7 |
| Literature: Kametani, Tetsuji; Kanaya, Naoaki; Ihara, Masataka Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 959 - 963 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(3-acetamidopropionyl)formanilide |
| Acetamide,N-[3-[2-(formylamino)phenyl]-3-oxopropyl] |
| 3-acetylamino-2'-formylaminopropiophenone |