Acetamide,2,2,2-trifluoro-N-(5-nitro-2-thiazolyl)-
Modify Date: 2024-01-02 13:58:07
Acetamide,2,2,2-trifluoro-N-(5-nitro-2-thiazolyl)- structure
|
Common Name | Acetamide,2,2,2-trifluoro-N-(5-nitro-2-thiazolyl)- | ||
|---|---|---|---|---|
| CAS Number | 659-13-2 | Molecular Weight | 241.14800 | |
| Density | 1.807g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H2F3N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-N-(5-nitrothiazol-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.807g/cm3 |
|---|---|
| Molecular Formula | C5H2F3N3O3S |
| Molecular Weight | 241.14800 |
| Exact Mass | 240.97700 |
| PSA | 116.05000 |
| LogP | 2.14830 |
| Index of Refraction | 1.573 |
| InChIKey | ZPAQSAGBSCBVFZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)C(F)(F)F |
|
~%
Acetamide,2,2,2... CAS#:659-13-2 |
| Literature: Michaels,R.M.; Strube,R.E. Journal of Pharmacy and Pharmacology, 1961 , vol. 13, p. 601 - 610 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Trifluor-1-<trifluormethyl-hydroxy-methoxy>-ethanol |
| 2-Trifluoracetamido-5-nitropyrimidin |
| 2,2,2,2',2',2'-hexafluoro-1,1'-oxy-bis-ethanol |
| 2-Trifluoracetamido-5-nitrothiazol |