GW542573X structure
|
Common Name | GW542573X | ||
|---|---|---|---|---|
| CAS Number | 660846-41-3 | Molecular Weight | 364.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28N2O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of GW542573XGW542573X is a potent and selective Ca2+-activated K+ 2 (SK2) channels activator. GW542573X induces the Ca2+-response curve of hSK1 that left-shifted from an EC50 (Ca2+) value of 410 nM to 240 nM[1]. |
| Name | 2-Methyl-2-propanyl 4-({[(2-methoxyphenyl)carbamoyl]oxy}methyl)-1 -piperidinecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | GW542573X is a potent and selective Ca2+-activated K+ 2 (SK2) channels activator. GW542573X induces the Ca2+-response curve of hSK1 that left-shifted from an EC50 (Ca2+) value of 410 nM to 240 nM[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H28N2O5 |
|---|---|
| Molecular Weight | 364.44 |
| Exact Mass | 364.20000 |
| PSA | 80.59000 |
| LogP | 3.84230 |
| InChIKey | SAXGSDIZIYFNKD-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)OCC1CCN(C(=O)OC(C)(C)C)CC1 |
| DAU 5884 hydrochloride |