7-Acetyl-4-methoxy-1,3-benzothiazol-2(3H)-one structure
|
Common Name | 7-Acetyl-4-methoxy-1,3-benzothiazol-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 662111-32-2 | Molecular Weight | 223.24800 | |
| Density | 1.344g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-Acetyl-4-methoxy-1,3-benzothiazol-2(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.24800 |
| Exact Mass | 223.03000 |
| PSA | 87.66000 |
| LogP | 2.21310 |
| Index of Refraction | 1.61 |
| InChIKey | GLXAKGKKKOJERU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)=O)c2sc(=O)[nH]c12 |
|
~82%
7-Acetyl-4-meth... CAS#:662111-32-2 |
| Literature: Stocks, Michael J.; Alcaraz, Lilian; Bailey, Andrew; Bonnert, Roger; Cadogan, Elaine; Christie, Jadeen; Connolly, Stephen; Cook, Anthony; Fisher, Adrian; Flaherty, Alice; Hill, Stephen; Humphries, Alexander; Ingall, Anthony; Jordan, Stephen; Lawson, Mandy; Mullen, Alex; Nicholls, David; Paine, Stuart; Pairaudeau, Garry; St-Gallay, Stephen; Young, Alan Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 13 p. 4027 - 4031 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(8-hydroxy-3-methylimidazo[1,5-a]pyrazin-7(8H)-yl)ethanone |
| 7-acetyl-3-methyl-7,8-dihydro-imidazo[1,5-a]pyrazin-8-ol |
| 7-acetyl-4-fluoroindole |
| 7-acetyl-4-methoxybenzo[d]thiazol-2(3H)-one |