(4-phenylmethoxyphenyl) propanoate structure
|
Common Name | (4-phenylmethoxyphenyl) propanoate | ||
|---|---|---|---|---|
| CAS Number | 6628-99-5 | Molecular Weight | 256.29600 | |
| Density | 1.122g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161ºC | |
| Name | (4-phenylmethoxyphenyl) propanoate |
|---|
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 161ºC |
| Exact Mass | 256.11000 |
| PSA | 35.53000 |
| LogP | 3.58100 |
| Index of Refraction | 1.556 |
| InChIKey | LWRGTCDBZBVPFB-UHFFFAOYSA-N |
| SMILES | CCC(=O)Oc1ccc(OCc2ccccc2)cc1 |
|
~71%
(4-phenylmethox... CAS#:6628-99-5 |
| Literature: Neubert, Mary E.; Wildman, Patricia J.; Zawaski, Michael J.; Hanlon, Carol A.; Benyo, Theresa L.; Vries, Adriaan De Molecular Crystals and Liquid Crystals (1969-1991), 1987 , vol. 145, p. 111 - 158 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |