5-hydroxy-4-methyl-2-nitro-benzoic acid structure
|
Common Name | 5-hydroxy-4-methyl-2-nitro-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6632-24-2 | Molecular Weight | 197.14500 | |
| Density | 1.243g/cm3 | Boiling Point | 532.5ºC at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.6ºC | |
| Name | 5-hydroxy-4-methyl-2-nitro-benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 532.5ºC at 760 mmHg |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14500 |
| Flash Point | 234.6ºC |
| Exact Mass | 197.03200 |
| PSA | 103.35000 |
| LogP | 1.83020 |
| Index of Refraction | 1.622 |
| InChIKey | VWKYIUHTPODUGT-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c(C(=O)O)cc1O |
|
~%
5-hydroxy-4-met... CAS#:6632-24-2 |
| Literature: Gardner; Grove Journal of the Chemical Society, 1953 , p. 3646 |
|
~%
5-hydroxy-4-met... CAS#:6632-24-2 |
| Literature: Gardner; Grove Journal of the Chemical Society, 1953 , p. 3646 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Nitro-3,4-kresotsaeure |
| 5-Hydroxy-4-methyl-2-nitro-benzoesaeure |
| 5-hydroxy-4-methyl-2-formylpyridine thiosemicarbazone |
| 5-hydroxy-4-methylpyridine-2-carboxaldehyde thiosemicarbazone |
| 4-Methyl-5-hydroxypyridine-2-carboxaldehydethiosemicarbazone |