methyl 3-hydroxy-4-methyl-2-nitro-benzoate structure
|
Common Name | methyl 3-hydroxy-4-methyl-2-nitro-benzoate | ||
|---|---|---|---|---|
| CAS Number | 71788-49-3 | Molecular Weight | 211.17100 | |
| Density | 1.372g/cm3 | Boiling Point | 327.6ºC at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | methyl 3-hydroxy-4-methyl-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 327.6ºC at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Flash Point | 151.9ºC |
| Exact Mass | 211.04800 |
| PSA | 92.35000 |
| LogP | 1.91860 |
| Index of Refraction | 1.58 |
| InChIKey | LTGNNMNPRYIBRG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C)c(O)c1[N+](=O)[O-] |
|
~69%
methyl 3-hydrox... CAS#:71788-49-3 |
| Literature: Chu, Wenhua; Kamitori, Shigehiro; Shinomiya, Miho; Carlson, Robert G.; Takusagawa, Fusao Journal of the American Chemical Society, 1994 , vol. 116, # 6 p. 2243 - 2253 |
|
~70%
methyl 3-hydrox... CAS#:71788-49-3 |
| Literature: Pasceri, Raffaele; Siegel, David; Ross, David; Moody, Christopher J. Journal of Medicinal Chemistry, 2013 , vol. 56, # 8 p. 3310 - 3317 |
|
~%
methyl 3-hydrox... CAS#:71788-49-3 |
| Literature: Brockmann; Muxfeldt Chemische Berichte, 1958 , vol. 91, p. 1242,1263 |
| Methyl-2-nitro-3,4-kresolat |
| 3-Hydroxy-4-methyl-2-nitro-benzoesaeure-methylester |
| 3-hydroxy-4-methyl-2-nitro-benzoic acid methyl ester |
| 2-Nitro-3,4-kresotinsaeure-methylester |
| methyl 3-hydroxy-2-nitro-4-methylbenzoate |
| methyl 3-hydroxy-4-methyl-2-nitro-benzoate |