DMAC-PDB structure
|
Common Name | DMAC-PDB | ||
|---|---|---|---|---|
| CAS Number | 663599-04-0 | Molecular Weight | 300.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DMAC-PDBDMAC-PDB is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | DMAC-PDB |
|---|
| Description | DMAC-PDB is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Molecular Formula | C12H16N2O3S2 |
|---|---|
| Molecular Weight | 300.40 |
| InChIKey | BLJGVBXSYKCBFC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(SSCCCC(=O)O)nc1 |