DMAC-SPDB structure
|
Common Name | DMAC-SPDB | ||
|---|---|---|---|---|
| CAS Number | 663599-05-1 | Molecular Weight | 397.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19N3O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DMAC-SPDBDMAC-SPDB is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | DMAC-SPDB |
|---|
| Description | DMAC-SPDB is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C16H19N3O5S2 |
|---|---|
| Molecular Weight | 397.47 |
| InChIKey | XDZYHHAHYBOELZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(SSCCCC(=O)ON2C(=O)CCC2=O)nc1 |