DMAC-SPDB-sulfo
Modify Date: 2025-08-23 17:40:37
DMAC-SPDB-sulfo structure
|
Common Name | DMAC-SPDB-sulfo | ||
|---|---|---|---|---|
| CAS Number | 663599-07-3 | Molecular Weight | 477.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19N3O8S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DMAC-SPDB-sulfoDMAC-SPDB-sulfo is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | DMAC-SPDB-sulfo |
|---|
| Description | DMAC-SPDB-sulfo is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C16H19N3O8S3 |
|---|---|
| Molecular Weight | 477.53 |
| InChIKey | KMRAQLKAJPMTOK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(SSCCCC(=O)ON2C(=O)CC(S(=O)(=O)O)C2=O)nc1 |