1H-Pyrrole-2,5-dione,1-(2,5-dichlorophenyl)-
Modify Date: 2025-09-10 22:43:01
1H-Pyrrole-2,5-dione,1-(2,5-dichlorophenyl)- structure
|
Common Name | 1H-Pyrrole-2,5-dione,1-(2,5-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6637-47-4 | Molecular Weight | 242.05800 | |
| Density | 1.57g/cm3 | Boiling Point | 374.2ºC at 760 mmHg | |
| Molecular Formula | C10H5Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.1ºC | |
| Name | 1-(2,5-dichlorophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 374.2ºC at 760 mmHg |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.05800 |
| Flash Point | 180.1ºC |
| Exact Mass | 240.97000 |
| PSA | 37.38000 |
| LogP | 2.48780 |
| Index of Refraction | 1.648 |
| InChIKey | WGGQQECAPZLVDV-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1cc(Cl)ccc1Cl |
| HS Code | 2925190090 |
|---|
|
~%
1H-Pyrrole-2,5-... CAS#:6637-47-4 |
| Literature: Kretow; Kul'tschizkaja Zhurnal Obshchei Khimii, 1956 , vol. 26, p. 208,211 engl.Ausg., 1956 , vol. 26, p. 221,223 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| f3188-0063 |