2,4-dichloro-6-[(cyclohexylamino)methyl]phenol structure
|
Common Name | 2,4-dichloro-6-[(cyclohexylamino)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 6640-29-5 | Molecular Weight | 274.18600 | |
| Density | 1.28g/cm3 | Boiling Point | 375.1ºC at 760 mmHg | |
| Molecular Formula | C13H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | 2,4-dichloro-6-[(cyclohexylamino)methyl]phenol |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 375.1ºC at 760 mmHg |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.18600 |
| Flash Point | 180.6ºC |
| Exact Mass | 273.06900 |
| PSA | 32.26000 |
| LogP | 4.51220 |
| Index of Refraction | 1.587 |
| InChIKey | XMSSXBOVAWDLSY-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)cc1CNC1CCCCC1 |
|
~%
2,4-dichloro-6-... CAS#:6640-29-5 |
| Literature: Burke,W.J. et al. Journal of Organic Chemistry, 1964 , vol. 29, p. 909 - 912 |