H-Ser-Leu-OH structure
|
Common Name | H-Ser-Leu-OH | ||
|---|---|---|---|---|
| CAS Number | 6665-16-3 | Molecular Weight | 218.25 | |
| Density | 1.256g/cm3 | Boiling Point | 465.8ºC at 760 mmHg | |
| Molecular Formula | C9H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.5ºC | |
Use of H-Ser-Leu-OHSerylleucine is a dipeptide. Serylleucine's core 1 o-glycosylated peptide (SLC1G) can be detected in urine as a metabolite and is a biomarker in TB studies[1]. |
| Name | H-Ser-Leu-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Serylleucine is a dipeptide. Serylleucine's core 1 o-glycosylated peptide (SLC1G) can be detected in urine as a metabolite and is a biomarker in TB studies[1]. |
|---|---|
| Related Catalog |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 465.8ºC at 760 mmHg |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 |
| Flash Point | 235.5ºC |
| Exact Mass | 218.12700 |
| PSA | 112.65000 |
| LogP | 0.01270 |
| Index of Refraction | 1.652 |
| InChIKey | NFDYGNFETJVMSE-BQBZGAKWSA-N |
| SMILES | CC(C)CC(NC(=O)C(N)CO)C(=O)O |
| serylleucine |
| N-L-Seryl-L-leucin |
| L-ser-L-phe |
| Serin-phenylalanin |
| N-L-seryl-L-leucine |
| SER-PHE |
| L-seryl-L-leucine |
| L-seryl-L-phenylalanine |
| serineleucine |