6-Monohydroxyflavone structure
|
Common Name | 6-Monohydroxyflavone | ||
|---|---|---|---|---|
| CAS Number | 6665-83-4 | Molecular Weight | 238.238 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 450.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H10O3 | Melting Point | 234-236 °C(lit.) | |
| MSDS | N/A | Flash Point | 176.3±22.2 °C | |
Use of 6-Monohydroxyflavone6-Hydroxyflavone is a naturally occurring flavone, with anti-inflammatory activity. 6-Hydroxyflavone exhibits inhibitory effect towards bovine hemoglobin (BHb) glycation. 6-Hydroxyflavone can activate AKT, ERK 1/2, and JNK signaling pathways to effectively promote osteoblastic differentiation. 6-Hydroxyflavone inhibits the LPS-induced NO production[1] [2]. |
| Name | 6-Hydroxyflavone |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Hydroxyflavone is a naturally occurring flavone, with anti-inflammatory activity. 6-Hydroxyflavone exhibits inhibitory effect towards bovine hemoglobin (BHb) glycation. 6-Hydroxyflavone can activate AKT, ERK 1/2, and JNK signaling pathways to effectively promote osteoblastic differentiation. 6-Hydroxyflavone inhibits the LPS-induced NO production[1] [2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.1±45.0 °C at 760 mmHg |
| Melting Point | 234-236 °C(lit.) |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.238 |
| Flash Point | 176.3±22.2 °C |
| Exact Mass | 238.062988 |
| PSA | 50.44000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | GPZYYYGYCRFPBU-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2ccc(O)cc12 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2914400090 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 229-704-8 |
| 4H-1-Benzopyran-4-one, 6-hydroxy-2-phenyl- |
| 6-Monohydroxyflavone |
| MFCD00017329 |
| 6-hydroxy-2-phenylchromen-4-one |
| 6-Hydroxy-2-phenyl-4H-chromen-4-one |