pyridin-3-ylmethyl N-(3-chlorophenyl)carbamate structure
|
Common Name | pyridin-3-ylmethyl N-(3-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 6669-79-0 | Molecular Weight | 262.69200 | |
| Density | 1.348g/cm3 | Boiling Point | 374.9ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.5ºC | |
| Name | pyridin-3-ylmethyl N-(3-chlorophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 374.9ºC at 760 mmHg |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.69200 |
| Flash Point | 180.5ºC |
| Exact Mass | 262.05100 |
| PSA | 54.71000 |
| LogP | 3.49730 |
| Index of Refraction | 1.635 |
| InChIKey | FSQVPYCYDLWQNV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Cl)c1)OCc1cccnc1 |
|
~%
pyridin-3-ylmet... CAS#:6669-79-0 |
| Literature: Bachmann Journal of the American Chemical Society, 1935 , vol. 57, p. 555,556 |
|
~%
Detail
|
| Literature: Bachmann Journal of the American Chemical Society, 1935 , vol. 57, p. 555,556 |
| 2-Benzoyl-phenanthren |