2-(2,4-Difluorophenoxy)-2-methylpropanoic acid structure
|
Common Name | 2-(2,4-Difluorophenoxy)-2-methylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 667413-00-5 | Molecular Weight | 216.181 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 307.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H10F2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 139.5±23.7 °C | |
| Name | 2-(2,4-difluorophenoxy)-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.0±27.0 °C at 760 mmHg |
| Molecular Formula | C10H10F2O3 |
| Molecular Weight | 216.181 |
| Flash Point | 139.5±23.7 °C |
| Exact Mass | 216.059799 |
| PSA | 46.53000 |
| LogP | 2.20 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | LUUNNYIKQOANCC-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(F)cc1F)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
2-(2,4-Difluoro... CAS#:667413-00-5 |
| Literature: Astellas Pharma Inc. Patent: EP2298747 A1, 2011 ; Location in patent: Page/Page column 23 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2,4-Difluorophenoxy)-2-methylpropanoic acid |
| 2,6-dimethoxy-3,5-pyridinediamine 2hcl |
| Propanoic acid, 2-(2,4-difluorophenoxy)-2-methyl- |