D-Trimannuronic acid structure
|
Common Name | D-Trimannuronic acid | ||
|---|---|---|---|---|
| CAS Number | 66754-13-0 | Molecular Weight | 546.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of D-Trimannuronic acidD-Trimannuronic acid, an alginate oligomer is extracted from seaweed. D-Trimannuronic acid can induces TNF‐α secretion by mouse macrophage cell lines. D-Trimannuronic acid can be used for the research of pain and vascular dementia[1][2][3]. |
| Name | D-Trimannuronic acid |
|---|
| Description | D-Trimannuronic acid, an alginate oligomer is extracted from seaweed. D-Trimannuronic acid can induces TNF‐α secretion by mouse macrophage cell lines. D-Trimannuronic acid can be used for the research of pain and vascular dementia[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H26O19 |
|---|---|
| Molecular Weight | 546.39 |
| InChIKey | LCLHHZYHLXDRQG-BUOBQAFFSA-N |
| SMILES | O=C(O)C1OC(OC2C(C(=O)O)OC(OC3C(C(=O)O)OC(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O |