Jatrorrhizine Hydrochloride structure
|
Common Name | Jatrorrhizine Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 6681-15-8 | Molecular Weight | 374.83800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Jatrorrhizine HydrochlorideJatrorrhizine chloride is a potent and orally active uptake-2 transporter inhibitor, it can be isolated from various Chinese medicinal plants[1]. Jatrorrhizine chloride exhibits a critical neuroprotective role in H2O2-induced apoptosis via inhibition of MAPK pathway in HT22 hippocampal neurons[2]. |
| Name | jatrorrhizine hcl(rg) |
|---|---|
| Synonym | More Synonyms |
| Description | Jatrorrhizine chloride is a potent and orally active uptake-2 transporter inhibitor, it can be isolated from various Chinese medicinal plants[1]. Jatrorrhizine chloride exhibits a critical neuroprotective role in H2O2-induced apoptosis via inhibition of MAPK pathway in HT22 hippocampal neurons[2]. |
|---|---|
| Related Catalog | |
| Target |
Uptake-2 transporter[1] |
| In Vitro | Organic cation transporters (OCTs) and the plasma membrane monoamine transporter (PMAT) are major uptake-2 transporters[1]. Jatrorrhizine chloride significantly inhibits the plasma membrane monoamine transporter (PMAT) -mediated MPP+ uptake in a concentration-dependent manner with an IC50 value of 1.05 μM[1]. Jatrorrhizine chloride demonstrates a more powerful inhibition on serotonin (5-HT) and norepinephrine (NE) uptake mediated by hOCT2 and hOCT3 than that mediated by PMAT[1]. Jatrorrhizine chloride attenuates the H2O2-induced Bcl-2/Bax ratio reduction and caspase-3 activation in these neurons[2]. |
| References |
| Molecular Formula | C20H20ClNO4 |
|---|---|
| Molecular Weight | 374.83800 |
| Exact Mass | 374.11600 |
| PSA | 51.80000 |
| LogP | 3.88380 |
| InChIKey | JKMUUZMCSNHBAX-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1O)CC[n+]1cc3c(OC)c(OC)ccc3cc1-2.[Cl-] |
| Jatorrhizine,chloride |
| 3-Hydroxy-2,9,10-trimethoxy-5,6-dihydro-isochino[3,2-a]isochinolinylium,Chlorid |
| Jatrorrhizine chloride |
| 3-hydroxy-2,9,10-trimethoxy-5,6-dihydro-isoquino[3,2-a]isoquinolinylium,chloride |
| JatrorrhizineHydrochloride |
| Neprotine chloride |
| Jatrochizine chloride |
| Jatrorrhizine Hydrochloride |