2-oxogluconic acid
2-oxogluconic acid structure
|
Common Name | 2-oxogluconic acid | ||
|---|---|---|---|---|
| CAS Number | 669-90-9 | Molecular Weight | 194.13900 | |
| Density | 1.941g/cm3 | Boiling Point | 528.6ºC at 760 mmHg | |
| Molecular Formula | C6H10O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-dehydro-D-gluconic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.941g/cm3 |
|---|---|
| Boiling Point | 528.6ºC at 760 mmHg |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.13900 |
| Flash Point | 225ºC |
| Exact Mass | 194.04300 |
| PSA | 135.29000 |
| Index of Refraction | 1.663 |
| InChIKey | VBUYCZFBVCCYFD-JJYYJPOSSA-N |
| SMILES | O=C(O)C(=O)C(O)C(O)C(O)CO |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 3 | |
CAS#:643-71-0
CAS#:526-95-4
CAS#:90-80-2
CAS#:2595-33-7
CAS#:57-48-7
CAS#:492-62-6
CAS#:32746-79-5
CAS#:2280-44-6
CAS#:7732-18-5
CAS#:7782-50-5
CAS#:3646-68-2
CAS#:127-17-3
CAS#:89-65-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| epifriedelinyl acetate |
| Fremy's salt |
| epi-friedelanol acetate |
| 2-oxogluconic acid |
| epi-friedelanyl acetate |
| friedelanol methyl ether |
| fructonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-dehydro-D-gluconic acid? |
| A: InChIKey of 2-dehydro-D-gluconic acid is VBUYCZFBVCCYFD-JJYYJPOSSA-N. |
| Q: What are the upstream materials of 2-dehydro-D-gluconic acid? |
| A: Related upstream materials(CAS) of 2-dehydro-D-gluconic acid: 643-71-0;526-95-4;90-80-2;2595-33-7;57-48-7;492-62-6;32746-79-5;2280-44-6;7732-18-5;7782-50-5. |
| Q: What are the downstream products of 2-dehydro-D-gluconic acid? |
| A: Related downstream products(CAS) of 2-dehydro-D-gluconic acid: 3646-68-2;127-17-3;89-65-6. |
| Q: What is the molecular weight of 2-dehydro-D-gluconic acid? |
| A: Molecular weight of 2-dehydro-D-gluconic acid is 194.13900. |
| Q: What is the SMILES notation of 2-dehydro-D-gluconic acid? |
| A: SMILES notation of 2-dehydro-D-gluconic acid is O=C(O)C(=O)C(O)C(O)C(O)CO. |
| Q: What is the polar surface area (PSA) of 2-dehydro-D-gluconic acid? |
| A: Polar surface area (PSA) of 2-dehydro-D-gluconic acid is 135.29000. |
| Q: What is the English name of 2-dehydro-D-gluconic acid? |
| A: The English name of 2-dehydro-D-gluconic acid is 2-dehydro-D-gluconic acid. |
| Q: What is the boiling point of 2-dehydro-D-gluconic acid? |
| A: Boiling point of 2-dehydro-D-gluconic acid is 528.6ºC at 760 mmHg. |
| Q: What English synonyms does 2-dehydro-D-gluconic acid have? |
| A: English synonyms of 2-dehydro-D-gluconic acid: epifriedelinyl acetate, Fremy's salt, epi-friedelanol acetate, 2-oxogluconic acid, epi-friedelanyl acetate, friedelanol methyl ether, fructonic acid. |
| Q: What is the CAS number of 2-dehydro-D-gluconic acid? |
| A: CAS number of 2-dehydro-D-gluconic acid is 669-90-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |