L-Leucine,N-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl]- (9CI) structure
|
Common Name | L-Leucine,N-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6707-71-7 | Molecular Weight | 318.32500 | |
| Density | 1.323 g/cm3 | Boiling Point | 571.5ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.4ºC | |
| Name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323 g/cm3 |
|---|---|
| Boiling Point | 571.5ºC at 760 mmHg |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.32500 |
| Flash Point | 299.4ºC |
| Exact Mass | 318.12200 |
| PSA | 103.78000 |
| LogP | 1.22690 |
| Index of Refraction | 1.578 |
| InChIKey | KYHBJUCZZYAJIQ-LBPRGKRZSA-N |
| SMILES | CC(C)CC(NC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)O |
| HS Code | 2925190090 |
|---|
|
~%
L-Leucine,N-[(1... CAS#:6707-71-7 |
| Literature: Yamashita; Sahashi Nippon Nogei Kagaku Kaishi, 1954 , vol. 28, p. 672 Chem.Abstr., 1955 , p. 7526 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-Phthalyl-Gly-Leucin |