Ethyl [(tert-Butyldimethylsilyl)oxy]acetate structure
|
Common Name | Ethyl [(tert-Butyldimethylsilyl)oxy]acetate | ||
|---|---|---|---|---|
| CAS Number | 67226-78-2 | Molecular Weight | 218.36500 | |
| Density | 0.912g/cm3 | Boiling Point | 215.8ºC at 760 mmHg | |
| Molecular Formula | C10H22O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70.2ºC | |
| Name | ethyl 2-[tert-butyl(dimethyl)silyl]oxyacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.912g/cm3 |
|---|---|
| Boiling Point | 215.8ºC at 760 mmHg |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.36500 |
| Flash Point | 70.2ºC |
| Exact Mass | 218.13400 |
| PSA | 35.53000 |
| LogP | 2.57130 |
| Index of Refraction | 1.42 |
| InChIKey | VMYQJDCENDEETH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CO[Si](C)(C)C(C)(C)C |
| Storage condition | 2-8°C |
|
~99%
Ethyl [(tert-Bu... CAS#:67226-78-2 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 67, # 6 p. 1708 - 1716 |
|
~%
Ethyl [(tert-Bu... CAS#:67226-78-2 |
| Literature: Journal of Organic Chemistry, , vol. 43, p. 3972 - 3974 |
|
~%
Ethyl [(tert-Bu... CAS#:67226-78-2 |
| Literature: Journal of Organic Chemistry, , vol. 43, p. 3972 - 3974 |
| ETHYL [(TERT-BUTYLDIMETHYLSILYL)OXY]ACETATE |
| ethyl 2-((tert-butyldimethylsilyl)oxy)acetate |
| ethyl tert-butyldimethylsiloxyacetate |
| (tert-butyldimethylsilyloxy)-acetic acid ethyl ester |
| 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]acetic Acid Ethyl Ester |
| Acetic acid,[[(1,1-dimethylethyl)dimethylsilyl]oxy]-,ethyl ester |
| ethyl t-butyldimethylsiloxyacetate |
| (tert-butyl-dimethyl-silanyloxy)-acetic acid ethyl ester |
| tert-butyldimethylsilyloxyacetate |