2-[2-(4-methylphenyl)-2-oxo-ethyl]benzonitrile structure
|
Common Name | 2-[2-(4-methylphenyl)-2-oxo-ethyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 67237-71-2 | Molecular Weight | 235.28100 | |
| Density | 1.14g/cm3 | Boiling Point | 400.5ºC at 760 mmHg | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196ºC | |
| Name | 2-[2-(4-methylphenyl)-2-oxoethyl]benzonitrile |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 400.5ºC at 760 mmHg |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28100 |
| Flash Point | 196ºC |
| Exact Mass | 235.10000 |
| PSA | 40.86000 |
| LogP | 3.29208 |
| Index of Refraction | 1.595 |
| InChIKey | QIVOSEOVDVCHKR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Cc2ccccc2C#N)cc1 |
|
~%
2-[2-(4-methylp... CAS#:67237-71-2 |
| Literature: Tatsugi, Jiro; Izawa, Yasuji Journal of Chemical Research, Miniprint, 1988 , # 11 p. 2747 - 2763 |
|
~%
2-[2-(4-methylp... CAS#:67237-71-2 |
| Literature: Tatsugi, Jiro; Izawa, Yasuji Journal of Chemical Research, Miniprint, 1988 , # 11 p. 2747 - 2763 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |