5-Bromo-2-chloro-3-nitropyridine structure
|
Common Name | 5-Bromo-2-chloro-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 67443-38-3 | Molecular Weight | 237.44 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 285.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2BrClN2O2 | Melting Point | 64-69 °C | |
| MSDS | USA | Flash Point | 126.4±25.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
Use of 5-Bromo-2-chloro-3-nitropyridine5-Bromo-2-chloro-3-nitropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 5-Bromo-2-chloro-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Bromo-2-chloro-3-nitropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.4±35.0 °C at 760 mmHg |
| Melting Point | 64-69 °C |
| Molecular Formula | C5H2BrClN2O2 |
| Molecular Weight | 237.44 |
| Flash Point | 126.4±25.9 °C |
| Exact Mass | 235.898804 |
| PSA | 58.71000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | WWQQPSDIIVXFOX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1Cl |
| Storage condition | Refrigerator |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R21/22;R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933399090 |
|
~86%
5-Bromo-2-chlor... CAS#:67443-38-3 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED Patent: WO2007/129044 A1, 2007 ; Location in patent: Page/Page column 77 ; WO 2007/129044 A1 |
|
~91%
5-Bromo-2-chlor... CAS#:67443-38-3 |
| Literature: PFIZER JAPAN INC.; PFIZER INC. Patent: WO2007/102059 A1, 2007 ; Location in patent: Page/Page column 45 ; |
|
~%
5-Bromo-2-chlor... CAS#:67443-38-3 |
| Literature: US6465484 B1, ; US 6465484 B1 |
|
~52%
5-Bromo-2-chlor... CAS#:67443-38-3 |
| Literature: Boehringer Ingelheim Pharma KG Patent: US6200976 B1, 2001 ; US 6200976 B1 |
|
~%
5-Bromo-2-chlor... CAS#:67443-38-3 |
| Literature: US4665078 A1, ; US 4665078 A |
|
~%
5-Bromo-2-chlor... CAS#:67443-38-3 |
| Literature: Tetrahedron, , vol. 70, # 5 p. 1077 - 1083 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-2-chloro-3-nitropyridine |
| MFCD00234149 |
| Pyridine, 5-bromo-2-chloro-3-nitro- |