PENTANOICACID,3-AMINO-4-METHYL-,(3R)
PENTANOICACID,3-AMINO-4-METHYL-,(3R) structure
|
Common Name | PENTANOICACID,3-AMINO-4-METHYL-,(3R) | ||
|---|---|---|---|---|
| CAS Number | 67654-57-3 | Molecular Weight | 221.25200 | |
| Density | 1.114 g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (R)-N-Acetyl-beta-phenylalanine methyl ester, also known as Methyl (R)-3-acetamido-3-phenylpropanoate, with chemical name PENTANOICACID,3-AMINO-4-METHYL-,(3R)-, CAS number 67654-57-3, molecular formula C12H15NO3, and molecular weight 221.25200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (R)-3-acetamido-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.114 g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 55.40000 |
| LogP | 1.81780 |
| Index of Refraction | 1.513 |
| InChIKey | KAZREVDICMUGDL-LLVKDONJSA-N |
| SMILES | COC(=O)CC(NC(C)=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 2 | |
CAS#:72569-96-1
CAS#:136744-88-2
CAS#:614-27-7
CAS#:37088-66-7
CAS#:75-36-5
CAS#:67-56-1
CAS#:333380-82-8
CAS#:18107-18-1
CAS#:70272-01-4
CAS#:614-19-7
CAS#:170564-98-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (R)-methyl-3-acetamido-3-phenylpropanoate |
| methyl (S)-3-acetylamino-3-phenylpropionate |
| (-)-S-methyl 3-amino-3-phenylpropanoate acetamide |
| 3-acetylamino-(R)-3-phenylpropionic acid methyl ester |
| methyl (S)-3-acetamido-3-phenylpropanoate |
| (S)-methyl 3-acetamido-3-phenyl-propanoate |
| methyl 3-acetylamino-3-phenylpropanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: LogP of Methyl (R)-3-acetamido-3-phenylpropanoate is 1.81780. |
| Q: What is the boiling point of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: Boiling point of Methyl (R)-3-acetamido-3-phenylpropanoate is 406.1ºC at 760 mmHg. |
| Q: What is the InChIKey of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: InChIKey of Methyl (R)-3-acetamido-3-phenylpropanoate is KAZREVDICMUGDL-LLVKDONJSA-N. |
| Q: What is the SMILES notation of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: SMILES notation of Methyl (R)-3-acetamido-3-phenylpropanoate is COC(=O)CC(NC(C)=O)c1ccccc1. |
| Q: What is the CAS number of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: CAS number of Methyl (R)-3-acetamido-3-phenylpropanoate is 67654-57-3. |
| Q: What are the downstream products of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: Related downstream products(CAS) of Methyl (R)-3-acetamido-3-phenylpropanoate: 614-19-7;170564-98-4. |
| Q: What are the upstream materials of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: Related upstream materials(CAS) of Methyl (R)-3-acetamido-3-phenylpropanoate: 72569-96-1;136744-88-2;614-27-7;37088-66-7;75-36-5;67-56-1;333380-82-8;18107-18-1;70272-01-4. |
| Q: What is the molecular formula of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: Molecular formula of Methyl (R)-3-acetamido-3-phenylpropanoate is C12H15NO3. |
| Q: What is the polar surface area (PSA) of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: Polar surface area (PSA) of Methyl (R)-3-acetamido-3-phenylpropanoate is 55.40000. |
| Q: What is the English name of Methyl (R)-3-acetamido-3-phenylpropanoate? |
| A: The English name of Methyl (R)-3-acetamido-3-phenylpropanoate is Methyl (R)-3-acetamido-3-phenylpropanoate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |