2-benzyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate structure
|
Common Name | 2-benzyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 67822-75-7 | Molecular Weight | 281.26300 | |
| Density | 1.454g/cm3 | Boiling Point | 520.4ºC at 760 mmHg | |
| Molecular Formula | C16H11NO4 | Melting Point | 198-201 °C | |
| MSDS | N/A | Flash Point | 268.6ºC | |
| Name | 2-Benzyl-1,3-dioxoisoindoline-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 520.4ºC at 760 mmHg |
| Melting Point | 198-201 °C |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.26300 |
| Flash Point | 268.6ºC |
| Exact Mass | 281.06900 |
| PSA | 74.68000 |
| LogP | 2.11890 |
| Index of Refraction | 1.687 |
| InChIKey | KGHOAEZOEVGKMU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925190090 |
|
~80%
2-benzyl-1,3-di... CAS#:67822-75-7 |
| Literature: Nikpour, Farzad; Mogaddam, Baran Mohammadi Heterocycles, 2008 , vol. 75, # 9 p. 2289 - 2292 |
|
~%
2-benzyl-1,3-di... CAS#:67822-75-7 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 34, # 7 p. 663 - 668 |
|
~%
2-benzyl-1,3-di... CAS#:67822-75-7 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 34, # 7 p. 663 - 668 |
|
~%
2-benzyl-1,3-di... CAS#:67822-75-7 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 34, # 7 p. 663 - 668 |
|
~%
2-benzyl-1,3-di... CAS#:67822-75-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 20 p. 4427 - 4431 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-benzyl-1H-isoindol-1,3(2H)-dione |
| BENZYLPHTHALIMIDE |
| 1H-Isoindole-1,3(2H)-dione,2-(phenylMethyl) |
| 2-benzylisoindole-1,3-dione |
| 2-Benzylisoindoline-1,3-dione |
| 2-(phenylmethyl)isoindole-1,3-dione |
| N-benzyl-1,3-dioxoisoindoline-5-carboxylic acid |
| 2-(phenylmethyl)-1H-isoindole-1,3(2H)-dione |
| 2-benzylisoindolin-1,3-dione-5-carboxylic acid |
| 2-(benzyl)isoindoline-1,3-quinone |
| N-BENZYLPHTALIMIDE |
| 2-Benzyl-1,3-isoindolinedione |