null structure
|
Common Name | null | ||
|---|---|---|---|---|
| CAS Number | 680-05-7 | Molecular Weight | 228.06500 | |
| Density | 1.492g/cm3 | Boiling Point | 76-77ºC | |
| Molecular Formula | C5H3F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 9.1ºC | |
| Name | Methyl Heptafluoroisobutyrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.492g/cm3 |
|---|---|
| Boiling Point | 76-77ºC |
| Molecular Formula | C5H3F7O2 |
| Molecular Weight | 228.06500 |
| Flash Point | 9.1ºC |
| Exact Mass | 228.00200 |
| PSA | 26.30000 |
| LogP | 1.99230 |
| Index of Refraction | 1.293 |
| InChIKey | CGMUKBZUGMXXEF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(C(F)(F)F)C(F)(F)F |
|
~50%
null CAS#:680-05-7 |
| Literature: Suyama, T.; Kato, S.; Mizutani, Y. Journal of Fluorine Chemistry, 1992 , vol. 56, # 1 p. 93 - 99 |
|
~%
null CAS#:680-05-7 |
| Literature: Journal of the American Chemical Society, , vol. 84, p. 4285 - 4288 |
| MFCD00633403 |
| methyl 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate |