7,3'-DIMETHOXYFLAVONE structure
|
Common Name | 7,3'-DIMETHOXYFLAVONE | ||
|---|---|---|---|---|
| CAS Number | 6802-49-9 | Molecular Weight | 282.29100 | |
| Density | 1.242g/cm3 | Boiling Point | 461ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.2ºC | |
| Name | 7-methoxy-2-(3-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 461ºC at 760 mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 206.2ºC |
| Exact Mass | 282.08900 |
| PSA | 48.67000 |
| LogP | 3.47720 |
| Index of Refraction | 1.598 |
| InChIKey | GUHXVSRRBMHSSC-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2cc(=O)c3ccc(OC)cc3o2)c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3',7-Dimethoxyflavone |
| Flavone,3',7-dimethoxy |
| 7-methoxy-2-(3-methoxy-phenyl)-chromen-4-one |
| 7,3'-Dimethoxyflavone |
| 7-Methoxy-2-(3-methoxy-phenyl)-chromen-4-on |