2,2-Bis(4-hydroxyphenyl)-4-methylpentane structure
|
Common Name | 2,2-Bis(4-hydroxyphenyl)-4-methylpentane | ||
|---|---|---|---|---|
| CAS Number | 6807-17-6 | Molecular Weight | 270.366 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 430.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C18H22O2 | Melting Point | 154ºC | |
| MSDS | N/A | Flash Point | 198.7±17.8 °C | |
| Name | 4-[2-(4-hydroxyphenyl)-4-methylpentan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.0±25.0 °C at 760 mmHg |
| Melting Point | 154ºC |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.366 |
| Flash Point | 198.7±17.8 °C |
| Exact Mass | 270.161987 |
| PSA | 40.46000 |
| LogP | 4.84 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | VHLLJTHDWPAQEM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| Hazard Codes | T,N |
|---|---|
| Risk Phrases | 60-36-50/53 |
| Safety Phrases | 53-45-60-61 |
| HS Code | 2907299090 |
|
~%
2,2-Bis(4-hydro... CAS#:6807-17-6 |
| Literature: Journal of the American Chemical Society, , vol. 61, p. 345 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,4'-(4-Methyl-2,2-pentanediyl)diphenol |
| 4,4'-(4-Methylpentane-2,2-diyl)diphenol |
| DSSTox_CID_9282 |
| Phenol, 4,4'-(1,3-dimethylbutylidene)bis- |