N-Succinimidyl p-nitrophenylacetate structure
|
Common Name | N-Succinimidyl p-nitrophenylacetate | ||
|---|---|---|---|---|
| CAS Number | 68123-33-1 | Molecular Weight | 278.218 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 463.6±47.0 °C at 760 mmHg | |
| Molecular Formula | C12H10N2O6 | Melting Point | 181ºC | |
| MSDS | N/A | Flash Point | 234.1±29.3 °C | |
| Name | N-Succinimidyl 4-Nitrophenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.6±47.0 °C at 760 mmHg |
| Melting Point | 181ºC |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.218 |
| Flash Point | 234.1±29.3 °C |
| Exact Mass | 278.053894 |
| PSA | 109.50000 |
| LogP | -0.30 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | JUEAHIVORWVODA-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26;S36/S37/S39 |
| HS Code | 2925190090 |
|
~%
N-Succinimidyl ... CAS#:68123-33-1 |
| Literature: WO2010/10380 A1, ; Page/Page column 51 ; WO 2010/010380 A1 |
|
~%
N-Succinimidyl ... CAS#:68123-33-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 3 p. 543 - 547 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-Pyrrolidinedione, 1-(((4-nitrophenyl)acetyl)oxy)- |
| 1-[2-(4-Nitrophenyl)acetoxy]pyrrolidine-2,5-dione |
| (2,5-dioxopyrrolidin-1-yl) 2-(4-nitrophenyl)acetate |
| 2,5-Pyrrolidinedione, 1-[[2-(4-nitrophenyl)acetyl]oxy]- |
| 1-[2-(4-Nitrophenyl)acetoxy]-2,5-pyrrolidinedione |
| N-Succinimidyl p-nitrophenylacetate |