6-acetamidonaphthalene-2-sulphonic acid structure
|
Common Name | 6-acetamidonaphthalene-2-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 68189-32-2 | Molecular Weight | 265.28500 | |
| Density | 1.478g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-acetamidonaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.478g/cm3 |
|---|---|
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.28500 |
| Exact Mass | 265.04100 |
| PSA | 91.85000 |
| LogP | 3.19870 |
| Index of Refraction | 1.678 |
| InChIKey | ANUPUAXCNMXHNF-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2cc(S(=O)(=O)O)ccc2c1 |
|
~%
6-acetamidonaph... CAS#:68189-32-2 |
| Literature: FUJIFILM Imaging Colorants Limited; FUJIFILM Corporation; FOSTER, Clive; DEVONALD, David; FUJIWARA, Toshiki Patent: EP2344589 B1, 2013 ; Location in patent: Paragraph 0096; 0097 ; |
|
~%
6-acetamidonaph... CAS#:68189-32-2 |
| Literature: Forster; Hanson; Watson Journal of the Society of Chemical Industry, London, 1928 , vol. 47, p. 156 T Chem. Zentralbl., 1928 , vol. 99, # II p. 768 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Acetamidonaphthalene-2-sulphonic acid |
| 6-Acetamino-naphthalin-sulfonsaeure-(2) |
| N-Acetyl-naphthylamin-(2)-sulfonsaeure-(6) |
| EINECS 269-189-7 |
| 6-acetamido-2-naphthalenesulfonic acid |
| 6-Acetylamino-naphthalin-2-sulfonsaeure |
| 6-acetylamino-naphthalene-2-sulfonic acid |
| 2-Acetamidonaphthalene-6-sulfonic acid |
| 2-acetaminonaphthalene-6-sulfonic acid |