6-amino-7-hydroxynaphthalene-2-sulphonic acid structure
|
Common Name | 6-amino-7-hydroxynaphthalene-2-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6399-72-0 | Molecular Weight | 239.24800 | |
| Density | 1.627g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-7-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.627g/cm3 |
|---|---|
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.24800 |
| Exact Mass | 239.02500 |
| PSA | 109.00000 |
| LogP | 3.03630 |
| Index of Refraction | 1.748 |
| InChIKey | MVGYYGCFVPMJAQ-UHFFFAOYSA-N |
| SMILES | Nc1cc2ccc(S(=O)(=O)O)cc2cc1O |
| HS Code | 2922299090 |
|---|
|
~%
6-amino-7-hydro... CAS#:6399-72-0 |
| Literature: Akt.-Ges. f. Anilinf. Patent: DE62964 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 497 Full Text Show Details Friedlaender; Oesterreich Chem. Zentralbl., 1899 , vol. 70, # I p. 288 |
|
~%
6-amino-7-hydro... CAS#:6399-72-0 |
| Literature: Hoechster Farbw. Patent: DE53076 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 2, p. 284 |
|
~%
6-amino-7-hydro... CAS#:6399-72-0 |
| Literature: Levi Giorn. Chim. ind. appl., 1921 , vol. 3, p. 299 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Amino-7-hydroxynaphthalene-2-sulphonic acid |
| 2-Naphthalenesulfonic acid,6-amino-7-hydroxy |
| 6-Amino-7-hydroxy-naphthalin-2-sulfonsaeure |
| EINECS 229-011-0 |
| 6-amino-7-hydroxy-naphthalene-2-sulfonic acid |
| 3-Amino-naphthol-(2)-sulfonsaeure-(7) |
| 2-amino-3-hydroxy-6-sulpho-naphthalene |
| 6-amino-7-hydroxy-2-naphthalenesulphonic acid |