6-Amino-2-naphthalenesulfonic acid
6-Amino-2-naphthalenesulfonic acid structure
|
Common Name | 6-Amino-2-naphthalenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 93-00-5 | Molecular Weight | 223.248 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 500ºC | |
| Molecular Formula | C10H9NO3S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-aminonaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 500ºC |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.248 |
| Exact Mass | 223.030319 |
| PSA | 88.77000 |
| LogP | 0.42 |
| Index of Refraction | 1.713 |
| InChIKey | SEMRCUIXRUXGJX-UHFFFAOYSA-N |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)ccc2c1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2921450090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:86-60-2
CAS#:81-05-0
CAS#:91-59-8
CAS#:117-62-4
CAS#:93-01-6
CAS#:81-16-3
CAS#:7664-93-9![[2]naphthylamine; sulfate Structure](https://image.chemsrc.com/caspic/455/74631-01-9.png)
CAS#:74631-01-9
CAS#:7664-41-7
CAS#:7446-11-9
CAS#:6838-02-4
CAS#:86-65-7
CAS#:525-37-1
CAS#:7724-15-4
CAS#:102878-14-8
CAS#:34322-51-5
CAS#:123289-89-4
CAS#:20096-53-1
CAS#:73022-40-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00035736 |
| 6-Amino-2-naphthalenesulfonic Acid Monohydrate |
| 6-Amino-2-naphthalenesulfonic acid |
| 6-aminonaphthalene-2-sulfonic acid |
| EINECS 202-208-9 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 6-aminonaphthalene-2-sulfonic acid have? |
| A: English synonyms of 6-aminonaphthalene-2-sulfonic acid: MFCD00035736, 6-Amino-2-naphthalenesulfonic Acid Monohydrate, 6-Amino-2-naphthalenesulfonic acid, 6-aminonaphthalene-2-sulfonic acid, EINECS 202-208-9. |
| Q: What is the InChIKey of 6-aminonaphthalene-2-sulfonic acid? |
| A: InChIKey of 6-aminonaphthalene-2-sulfonic acid is SEMRCUIXRUXGJX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-aminonaphthalene-2-sulfonic acid? |
| A: Molecular formula of 6-aminonaphthalene-2-sulfonic acid is C10H9NO3S. |
| Q: What is the molecular weight of 6-aminonaphthalene-2-sulfonic acid? |
| A: Molecular weight of 6-aminonaphthalene-2-sulfonic acid is 223.248. |
| Q: What is the English name of 6-aminonaphthalene-2-sulfonic acid? |
| A: The English name of 6-aminonaphthalene-2-sulfonic acid is 6-aminonaphthalene-2-sulfonic acid. |
| Q: What is the polar surface area (PSA) of 6-aminonaphthalene-2-sulfonic acid? |
| A: Polar surface area (PSA) of 6-aminonaphthalene-2-sulfonic acid is 88.77000. |
| Q: What is the SMILES notation of 6-aminonaphthalene-2-sulfonic acid? |
| A: SMILES notation of 6-aminonaphthalene-2-sulfonic acid is Nc1ccc2cc(S(=O)(=O)O)ccc2c1. |
| Q: What is the boiling point of 6-aminonaphthalene-2-sulfonic acid? |
| A: Boiling point of 6-aminonaphthalene-2-sulfonic acid is 500ºC. |
| Q: What is the safety information for 6-aminonaphthalene-2-sulfonic acid? |
| A: Safety information for 6-aminonaphthalene-2-sulfonic acid: S26-S36/37/39. |
| Q: What is the LogP of 6-aminonaphthalene-2-sulfonic acid? |
| A: LogP of 6-aminonaphthalene-2-sulfonic acid is 0.42. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |