1-(allyloxy)-2,2-bis[(allyloxy)methyl]butane structure
|
Common Name | 1-(allyloxy)-2,2-bis[(allyloxy)methyl]butane | ||
|---|---|---|---|---|
| CAS Number | 682-08-6 | Molecular Weight | 254.36500 | |
| Density | 0.906g/cm3 | Boiling Point | 305.1ºC at 760 mmHg | |
| Molecular Formula | C15H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.3ºC | |
| Name | 1-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)butane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.906g/cm3 |
|---|---|
| Boiling Point | 305.1ºC at 760 mmHg |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.36500 |
| Flash Point | 115.3ºC |
| Exact Mass | 254.18800 |
| PSA | 27.69000 |
| LogP | 2.99060 |
| Index of Refraction | 1.453 |
| InChIKey | JPTSCQGFFOSLQE-UHFFFAOYSA-N |
| SMILES | C=CCOCC(CC)(COCC=C)COCC=C |
| HS Code | 2909199090 |
|---|
|
~99%
1-(allyloxy)-2,... CAS#:682-08-6 |
| Literature: Matsumura, Yasufumi; Komiyama, Hiromi Patent: US2003/135059 A1, 2003 ; |
|
~87%
1-(allyloxy)-2,... CAS#:682-08-6 |
| Literature: BIO-NANO POWER; Long, Nathan R.; Wang, Jie; Abdelhady, Hosam Gharib Patent: US2013/330293 A1, 2013 ; Location in patent: Paragraph 0508; 0509; 0510; 0511 ; |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| trimethylolpropane allyl ether |
| EINECS 211-660-6 |
| trimethylolpropane triallyl ether |