Micheliolide structure
|
Common Name | Micheliolide | ||
|---|---|---|---|---|
| CAS Number | 68370-47-8 | Molecular Weight | 248.318 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 426.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8±21.5 °C | |
Use of MicheliolideMicheliolide could effectively attenuate the high glucose-stimulated activation of NF-κB, the degradation of IκBα, and the expression of MCP-1, TGF-β1 and FN in rat mesangial cells (MCs). |
| Name | (3aS,9R,9aS,9bS)-9-hydroxy-6,9-dimethyl-3-methylidene-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Micheliolide could effectively attenuate the high glucose-stimulated activation of NF-κB, the degradation of IκBα, and the expression of MCP-1, TGF-β1 and FN in rat mesangial cells (MCs). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.1±45.0 °C at 760 mmHg |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.318 |
| Flash Point | 181.8±21.5 °C |
| Exact Mass | 248.141251 |
| PSA | 46.53000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | RDJAFOWISVMOJY-PWNZVWSESA-N |
| SMILES | C=C1C(=O)OC2C1CCC(C)=C1CCC(C)(O)C12 |
| Storage condition | -20°C |
| Azuleno[4,5-b]furan-2(3H)-one, 3a,4,5,7,8,9,9a,9b-octahydro-9-hydroxy-6,9-dimethyl-3-methylene-, (3aS,9R,9aS,9bS)- |
| (3aS,9R,9aS,9bS)-9-Hydroxy-6,9-dimethyl-3-methylene-3a,4,5,7,8,9,9a,9b-octahydroazuleno[4,5-b]furan-2(3H)-one |
| Mecheliolide |
| MICHELIOLIDE |