trifluoroacetyl triflate structure
|
Common Name | trifluoroacetyl triflate | ||
|---|---|---|---|---|
| CAS Number | 68602-57-3 | Molecular Weight | 246.08500 | |
| Density | 1.8103 (estimate) | Boiling Point | 62-63ºC(lit.) | |
| Molecular Formula | C3F6O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | Trifluoroacetyl Trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8103 (estimate) |
|---|---|
| Boiling Point | 62-63ºC(lit.) |
| Molecular Formula | C3F6O4S |
| Molecular Weight | 246.08500 |
| Exact Mass | 245.94200 |
| PSA | 68.82000 |
| LogP | 2.02230 |
| Vapour Pressure | 400 mm Hg ( 21.1 °C) |
| Index of Refraction | 1.296-1.3 |
| InChIKey | FWJGTOABGBFQNT-UHFFFAOYSA-N |
| SMILES | O=C(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| Storage condition | Refrigerator |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H314 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338-P310 |
| Hazard Codes | C |
| Risk Phrases | 20/21/22-34 |
| Safety Phrases | S26;S27;S28;S45;S36/S37/S39 |
| RIDADR | UN 3265 8/PG 1 |
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2915900090 |
|
~79%
trifluoroacetyl... CAS#:68602-57-3 |
| Literature: Forbus, T. R.; Taylor, S. L.; Martin, J. C. Journal of Organic Chemistry, 1987 , vol. 52, # 19 p. 4156 - 4159 |
|
~%
trifluoroacetyl... CAS#:68602-57-3 |
| Literature: Journal of Organic Chemistry, , vol. 52, # 19 p. 4156 - 4159 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| trifluoromethylsulfonyl 2,2,2-trifluoroacetate |
| MFCD00011638 |