(25R)-Spirost-4-ene-3,12-dione structure
|
Common Name | (25R)-Spirost-4-ene-3,12-dione | ||
|---|---|---|---|---|
| CAS Number | 6875-60-1 | Molecular Weight | 426.58800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (25R)-Spirost-4-ene-3,12-dione(25R)-Spirost-4-ene-3,12-dione ((-)-(25R)-Spirost-4-ene-3,12-dione) is a natural product that has an inhibitory effect on neutrophil superoxide anion production and histamine release from mast cells[1]. |
| Name | 25R-spirost-4-ene-3,12-dione |
|---|---|
| Synonym | More Synonyms |
| Description | (25R)-Spirost-4-ene-3,12-dione ((-)-(25R)-Spirost-4-ene-3,12-dione) is a natural product that has an inhibitory effect on neutrophil superoxide anion production and histamine release from mast cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H38O4 |
|---|---|
| Molecular Weight | 426.58800 |
| Exact Mass | 426.27700 |
| PSA | 52.60000 |
| LogP | 5.10110 |
| InChIKey | ZVWYBBDTSJOAHD-HGMFYQPQSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CCC5=CC(=O)CCC5(C)C4CC(=O)C3(C)C1C2C |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (25R)-spirost-4-ene-3,12-dione |
| 25R-spirost-4-en-3,12-dione |
| (25R)-Spirost-4-en-3,12-dion |