SU-11752 structure
|
Common Name | SU-11752 | ||
|---|---|---|---|---|
| CAS Number | 688036-19-3 | Molecular Weight | 493.575 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H27N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SU-11752SU-11752 is a potent, selective inhibitor of DNA-PK, >500-fold selectivity over PI3Kγ, inhibits DNA double-strand break repair in cells and sensitizs ionizing radiation in cancer cells.. |
| Name | 3-(2,4-Diethyl-5-{(Z)-[2-oxo-5-(phenylsulfamoyl)-1,2-dihydro-3H-indol-3-ylidene]methyl}-1H-pyrrol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.575 |
| Exact Mass | 493.167145 |
| LogP | 4.61 |
| Index of Refraction | 1.663 |
| InChIKey | QUYIGDGKOSEELL-QNGOZBTKSA-N |
| SMILES | CCc1[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Nc4ccccc4)cc32)c(CC)c1CCC(=O)O |
| 1H-Pyrrole-3-propanoic acid, 5-[(Z)-[1,2-dihydro-2-oxo-5-[(phenylamino)sulfonyl]-3H-indol-3-ylidene]methyl]-2,4-diethyl- |
| 3-(2,4-Diethyl-5-{(Z)-[2-oxo-5-(phenylsulfamoyl)-1,2-dihydro-3H-indol-3-ylidene]methyl}-1H-pyrrol-3-yl)propanoic acid |