[2-(2,6-Dichloro-3-hydroxyanilino)phenyl]acetic acid structure
|
Common Name | [2-(2,6-Dichloro-3-hydroxyanilino)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 69002-85-3 | Molecular Weight | 312.14800 | |
| Density | 1.52g/cm3 | Boiling Point | 429.5ºC at 760 mmHg | |
| Molecular Formula | C14H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 3'-hydroxydiclofenac |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 429.5ºC at 760 mmHg |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.14800 |
| Flash Point | 213.5ºC |
| Exact Mass | 311.01200 |
| PSA | 69.56000 |
| LogP | 4.14270 |
| Index of Refraction | 1.689 |
| InChIKey | HYPJZSYXUWYJDG-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccccc1Nc1c(Cl)ccc(O)c1Cl |
|
Name: Inhibition of COX (unknown origin)
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL2432168
|
|
Name: Inhibition of inflammatory hind paw edema, induced by Mycobacterium butyricum in rats...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL797721
|
|
Name: In vitro inhibition of bovine prostaglandin G/H synthase, using bovine seminal vesicl...
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL858257
|
| 2-[2-(2,6-dichloro-3-hydroxyanilino)phenyl]acetic acid |
| 3'-hydroxy diclofenac |
| 3'-OH DCF |