2,3-Dichloro-5-(trichloromethyl)pyridine structure
|
Common Name | 2,3-Dichloro-5-(trichloromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 69045-83-6 | Molecular Weight | 265.35200 | |
| Density | 1.636 | Boiling Point | 278-279ºC | |
| Molecular Formula | C6H2Cl5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150 °F | |
| Name | 2,3-Dichloro-5-(trichloromethyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.636 |
|---|---|
| Boiling Point | 278-279ºC |
| Molecular Formula | C6H2Cl5N |
| Molecular Weight | 265.35200 |
| Flash Point | 150 °F |
| Exact Mass | 262.86300 |
| PSA | 12.89000 |
| LogP | 4.21510 |
| Index of Refraction | 1.59 |
| InChIKey | XVBWGQSXLITICX-UHFFFAOYSA-N |
| SMILES | Clc1cc(C(Cl)(Cl)Cl)cnc1Cl |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~%
2,3-Dichloro-5-... CAS#:69045-83-6 |
| Literature: US4469896 A1, ; |
|
~%
2,3-Dichloro-5-... CAS#:69045-83-6 |
| Literature: US4419514 A1, ; |
|
~%
2,3-Dichloro-5-... CAS#:69045-83-6 |
| Literature: US4532111 A1, ; |
|
~%
2,3-Dichloro-5-... CAS#:69045-83-6 |
| Literature: Heterocycles, , vol. 22, # 1 p. 117 - 124 |
| Precursor 7 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03701543 |
| DSSTox_CID_9534 |
| 2,3,5-TRIFLUOROBENZOTRIFLUORIDE |
| 2,3-dichloro-5-(tri-chloromethyl)pyridine |
| Pyridine,2,3-dichloro-5-(trichloromethyl) |
| 5,6-dichloro-3-trichloromethyl pyridine |