(6R)-5,6,7,8-Tetrahydro-L-biopterin dihydrochloride structure
|
Common Name | (6R)-5,6,7,8-Tetrahydro-L-biopterin dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 69056-38-8 | Molecular Weight | 314.17 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 506.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C9H17Cl2N5O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 260.2±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (6R)-5,6,7,8-Tetrahydro-L-biopterin dihydrochlorideSapropterin dihydrochloride is a synthetic form of BH4 that is approved for the treatment of BH4 responsive PKU. (1) Sapropterin dihydrochloride can stimulate TH and TPH activities leading to improved dopamine and serotonin synthesis despite persistently elevated brain phenylalanine.(2) Sapropterin dihydrochloride is used to lower blood phenylalanine levels in tetrahydrobiopterin-responsive phenylketonuria in conjunction with a phenylalanine-restricted diet. |
| Name | sapropterin dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Sapropterin dihydrochloride is a synthetic form of BH4 that is approved for the treatment of BH4 responsive PKU. (1) Sapropterin dihydrochloride can stimulate TH and TPH activities leading to improved dopamine and serotonin synthesis despite persistently elevated brain phenylalanine.(2) Sapropterin dihydrochloride is used to lower blood phenylalanine levels in tetrahydrobiopterin-responsive phenylketonuria in conjunction with a phenylalanine-restricted diet. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 506.6±60.0 °C at 760 mmHg |
| Molecular Formula | C9H17Cl2N5O3 |
| Molecular Weight | 314.17 |
| Flash Point | 260.2±32.9 °C |
| PSA | 136.29000 |
| LogP | -4.22 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.822 |
| InChIKey | RKSUYBCOVNCALL-NTVURLEBSA-N |
| SMILES | CC(O)C(O)C1CNc2nc(N)[nH]c(=O)c2N1.Cl.Cl |
| Storage condition | −20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
(6R)-5,6,7,8-Te... CAS#:69056-38-8
(6R)-5,6,7,8-Te... CAS#:69056-38-8 |
| Literature: Australian Journal of Chemistry, , vol. 35, # 4 p. 785 - 793 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Tetrahydrobiopterin and cytokines.
Proc. Soc. Exp. Biol. Med. 203 , 1, (1993) Biosynthesis of tetrahydrobiopterin starts from guanosine triphosphate by the action of guanosine triphosphate cyclohydrolase I, which yields the first intermediate, 7,8-dihydroneopterin triphosphate.... |
|
|
Intravenous treatment of experimental Parkinson's disease in the mouse with an IgG-GDNF fusion protein that penetrates the blood-brain barrier.
Brain Res. 1352 , 208-13, (2010) Glial-derived neurotrophic factor (GDNF) is a trophic factor for the nigra-striatal tract in experimental Parkinson's disease (PD). The neurotrophin must be administered by intra-cerebral injection, b... |
|
|
A new resorufin-based alpha-glucosidase assay for high-throughput screening.
Anal. Biochem. 390 , 79-84, (2009) Mutations in alpha-glucosidase cause accumulation of glycogen in lysosomes, resulting in Pompe disease, a lysosomal storage disorder. Small molecule chaperones that bind to enzyme proteins and correct... |
| (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydropteridin-4(1H)-one dihydrochloride |
| (6R,1'R,2'S)-6-(1',2'-dihydroxypropyl)-5,6,7,8-tetrahydrobiopterin |
| Dapropterin |
| (6R)-2-Amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-4(1H)-pteridinone |
| (6R)-5,6,7,8-tetrahydro-L-biopterin |
| (6R)-Tetrahydrobiopterin |
| 6R-tetahydrobiopterin |
| Dapropterin dihydrochloride |
| Biopten |
| (6R)-5,6,7,8-TETRAHYDRO-L-BIOPTERIN DIHYDROCHLORIDE |
| 4(1H)-Pteridinone, 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-, (6R)-, hydrochloride (1:2) |
| sapropterinum |
| (6R)-2-Amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydropteridin-4(1H)-one |
| R-THBP |
| MFCD00891665 |
| (R)-2-Amino-6-((1R,2S)-1,2-dihydroxypropyl)-5,6,7,8-tetrahydropteridin-4(3H)-one dihydrochloride |
| (6R)-5,6,7,8-Tetrahydrobiopterin |
| (6R)-tetrahydrobiopterin dihydrochloride |
| 4(1H)-Pteridinone, 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-, (6R)- |
| [6R-[6R*(1R*,2S*)]]-2-amino-6-(1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4(1H)-pteridinone |
| (6R)-Tetrahydrobiopterin hydrochloride |
| (6R)-2-Amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-4(1H)-pteridinone dihydrochloride |
| Sapropterin |
| kuvan |
| (6R)-5,6,7,8-Tetrahydrobiopterin dihydrochloride |
| 6b-5,6,7,8-Tetrahydro-L-biopterin |
| (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-1H-pteridin-4-one,dihydrochloride |
| 6R-Tetrahydro-L-biopterin |
| (6R-(6R*(1R*,2S*)))-5,6,7,8-Tetrahydro-2-amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone dihydrochloride |
| R-THBP6R-BH4 |
| (6R)-L-erythro-5,6,7,8-Tetrahydrobiopterin |
| sapropterina |
| (6R)-L-erythro-Tetrahydrobiopterin |
| 4(1H)-pteridinone, 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-, (6R)-, dihydrochloride |
| Sapropterin dihydrochloride |
| Sapropterin (dihydrochloride) |