trichloro(2-trichlorosilylethenyl)silane
trichloro(2-trichlorosilylethenyl)silane structure
|
Common Name | trichloro(2-trichlorosilylethenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 692-52-4 | Molecular Weight | 294.92600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2H2Cl6Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trichloro(2-trichlorosilylethenyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C2H2Cl6Si2 |
|---|---|
| Molecular Weight | 294.92600 |
| Exact Mass | 291.78300 |
| LogP | 3.93160 |
| InChIKey | QALPWPXFWUARDY-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)C=C[Si](Cl)(Cl)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 3 | |
CAS#:74-86-2
CAS#:540-59-0
CAS#:79-01-6
CAS#:13465-77-5
CAS#:10038-98-9
CAS#:75-01-4
CAS#:690-18-6
CAS#:18038-55-6
CAS#:29442-46-4
CAS#:87061-56-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Bis-trichlorsilyl-ethylen |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of trichloro(2-trichlorosilylethenyl)silane? |
| A: InChIKey of trichloro(2-trichlorosilylethenyl)silane is QALPWPXFWUARDY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 692-52-4? |
| A: Chinese name of 692-52-4 is 692-52-4. |
| Q: What is the SMILES notation of trichloro(2-trichlorosilylethenyl)silane? |
| A: SMILES notation of trichloro(2-trichlorosilylethenyl)silane is Cl[Si](Cl)(Cl)C=C[Si](Cl)(Cl)Cl. |
| Q: What is the molecular weight of trichloro(2-trichlorosilylethenyl)silane? |
| A: Molecular weight of trichloro(2-trichlorosilylethenyl)silane is 294.92600. |
| Q: What is the CAS number of trichloro(2-trichlorosilylethenyl)silane? |
| A: CAS number of trichloro(2-trichlorosilylethenyl)silane is 692-52-4. |
| Q: What is the molecular formula of trichloro(2-trichlorosilylethenyl)silane? |
| A: Molecular formula of trichloro(2-trichlorosilylethenyl)silane is C2H2Cl6Si2. |
| Q: What are the upstream materials of trichloro(2-trichlorosilylethenyl)silane? |
| A: Related upstream materials(CAS) of trichloro(2-trichlorosilylethenyl)silane: 74-86-2;540-59-0;79-01-6;13465-77-5;10038-98-9;75-01-4;690-18-6. |
| Q: What English synonyms does trichloro(2-trichlorosilylethenyl)silane have? |
| A: English synonyms of trichloro(2-trichlorosilylethenyl)silane: 1,2-Bis-trichlorsilyl-ethylen. |
| Q: What is the LogP of trichloro(2-trichlorosilylethenyl)silane? |
| A: LogP of trichloro(2-trichlorosilylethenyl)silane is 3.93160. |
| Q: What are the downstream products of trichloro(2-trichlorosilylethenyl)silane? |
| A: Related downstream products(CAS) of trichloro(2-trichlorosilylethenyl)silane: 18038-55-6;29442-46-4;87061-56-1. |