Naphthalene,1,4-dinitro- structure
|
Common Name | Naphthalene,1,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 6921-26-2 | Molecular Weight | 218.16600 | |
| Density | 1.481 g/cm3 | Boiling Point | 386.1ºC at 760mmHg | |
| Molecular Formula | C10H6N2O4 | Melting Point | 134ºC | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | 1,4-dinitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.481 g/cm3 |
|---|---|
| Boiling Point | 386.1ºC at 760mmHg |
| Melting Point | 134ºC |
| Molecular Formula | C10H6N2O4 |
| Molecular Weight | 218.16600 |
| Flash Point | 197.7ºC |
| Exact Mass | 218.03300 |
| PSA | 91.64000 |
| LogP | 3.70260 |
| Index of Refraction | 1.704 |
| InChIKey | GQBQDMFMXMUHAA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])c2ccccc12 |
| HS Code | 2904209090 |
|---|
|
~%
Naphthalene,1,4... CAS#:6921-26-2 |
| Literature: Hodgson; Ward Journal of the Chemical Society, 1948 , p. 556,558 |
|
~%
Naphthalene,1,4... CAS#:6921-26-2 |
| Literature: Chudozilov Collection of Czechoslovak Chemical Communications, vol. 1, p. 305 Chem. Zentralbl., 1929 , vol. 100, # II p. 738 |
|
~%
Naphthalene,1,4... CAS#:6921-26-2 |
| Literature: Chudozilov Collection of Czechoslovak Chemical Communications, vol. 1, p. 304 Chem. Zentralbl., 1929 , vol. 100, # II p. 738 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,4-Dinitronaphthalene |
| 1,4-Dinitronaphthalin |
| Naphthalene,4-dinitro |
| Naphthalene,1,4-dinitro |
| 1,4-dinitro-naphthalene |