2-chloro-5-ethoxy-4-propan-2-yloxybenzaldehyde
Modify Date: 2025-08-26 08:56:22
2-chloro-5-ethoxy-4-propan-2-yloxybenzaldehyde structure
|
Common Name | 2-chloro-5-ethoxy-4-propan-2-yloxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 692267-55-3 | Molecular Weight | 242.69900 | |
| Density | 1.15g/cm3 | Boiling Point | 339.9ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.9ºC | |
| Name | 2-chloro-5-ethoxy-4-propan-2-yloxybenzaldehyde |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 339.9ºC at 760 mmHg |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.69900 |
| Flash Point | 134.9ºC |
| Exact Mass | 242.07100 |
| PSA | 35.53000 |
| LogP | 3.33840 |
| Index of Refraction | 1.529 |
| InChIKey | IDSQTTSPDCFWSG-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C=O)c(Cl)cc1OC(C)C |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |